C31H40F2O4S — CID 153139364
1-[4,4-difluoro-7-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]heptoxy]-2-methylprop-2-en-1-ol (PubChem CID 153139364) has the molecular formula C31H40F2O4S and a molecular weight of 546.72 g/mol. Its IUPAC name is 1-[4,4-difluoro-7-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]heptoxy]-2-methylprop-2-en-1-ol.
| Compound Name | 1-[4,4-difluoro-7-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]heptoxy]-2-methylprop-2-en-1-ol |
|---|---|
| PubChem CID | 153139364 |
| Molecular Formula | C31H40F2O4S |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | 1-[4,4-difluoro-7-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]sulfanyl]heptoxy]-2-methylprop-2-en-1-ol |
| SMILES | C=C(C)C(O)OCCCC(F)(F)CCCSc1ccc2cc(-c3ccc(CCCCC)cc3OC)oc2c1 |
| InChI | InChI=1S/C31H40F2O4S/c1-5-6-7-10-23-11-14-26(28(19-23)35-4)29-20-24-12-13-25(21-27(24)37-29)38-18-9-16-31(32,33)15-8-17-36-30(34)22(2)3/h11-14,19-21,30,34H,2,5-10,15-18H2,1,3-4H3 |
| InChIKey | VYHRFMAVXYULPB-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 51.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|