C28H28F6O3S — CID 146390672
[3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] 2-methylprop-2-enoate (PubChem CID 146390672) has the molecular formula C28H28F6O3S and a molecular weight of 558.58 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390672 |
| Molecular Formula | C28H28F6O3S |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.17 |
| IUPAC Name | [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]sulfanylmethyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CSc1ccc2cc(-c3ccc(CCCCC)cc3C(F)(F)F)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C28H28F6O3S/c1-4-5-6-7-18-8-11-22(23(12-18)28(32,33)34)25-13-19-9-10-21(14-24(19)37-25)38-16-20(27(29,30)31)15-36-26(35)17(2)3/h8-14,20H,2,4-7,15-16H2,1,3H3 |
| InChIKey | RNAKSKCVENFOHJ-UHFFFAOYSA-N |
| XLogP | 9.24 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|