C31H37F3O5 — CID 166777161
[2,4-dimethyl-4-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate (PubChem CID 166777161) has the molecular formula C31H37F3O5 and a molecular weight of 546.63 g/mol. Its IUPAC name is [2,4-dimethyl-4-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [2,4-dimethyl-4-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166777161 |
| Molecular Formula | C31H37F3O5 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | [2,4-dimethyl-4-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]pentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(C)CC(C)(C)Oc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)oc2c1 |
| InChI | InChI=1S/C31H37F3O5/c1-8-9-10-11-21-12-15-24(27(16-21)38-31(32,33)34)26-17-22-13-14-23(18-25(22)36-26)37-29(4,5)19-30(6,7)39-28(35)20(2)3/h12-18H,2,8-11,19H2,1,3-7H3 |
| InChIKey | DHSWHODBMBRXCJ-UHFFFAOYSA-N |
| XLogP | 9.18 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|