C34H44F6N2O5 — CID 155266322
[3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate (PubChem CID 155266322) has the molecular formula C34H44F6N2O5 and a molecular weight of 674.72 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate.
| Compound Name | [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 155266322 |
| Molecular Formula | C34H44F6N2O5 |
| Molecular Weight | 674.72 g/mol |
| Exact Mass | 674.32 |
| IUPAC Name | [3,3,3-trifluoro-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCC(COC(=O)C(C)(C)C(C)(N)CC(C)(C)N)C(F)(F)F)cc3o2)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C34H44F6N2O5/c1-7-8-9-10-21-11-14-25(28(15-21)47-34(38,39)40)27-16-22-12-13-24(17-26(22)46-27)44-18-23(33(35,36)37)19-45-29(43)31(4,5)32(6,42)20-30(2,3)41/h11-17,23H,7-10,18-20,41-42H2,1-6H3 |
| InChIKey | BZCRUIDLUAEIND-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 109.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.72 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|