C36H46F8N2O8 — CID 155265670
[2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate (PubChem CID 155265670) has the molecular formula C36H46F8N2O8 and a molecular weight of 786.75 g/mol. Its IUPAC name is [2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate.
| Compound Name | [2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate |
|---|---|
| PubChem CID | 155265670 |
| Molecular Formula | C36H46F8N2O8 |
| Molecular Weight | 786.75 g/mol |
| Exact Mass | 786.31 |
| IUPAC Name | [2-[[[1,1-difluoro-2-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]ethoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroethyl] 3,5-diamino-2,2,3,5-tetramethylhexanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCC(F)(F)OC(F)(F)OC(F)(F)OC(F)(F)COC(=O)C(C)(C)C(C)(N)CC(C)(C)N)cc3o2)c(OC)c1 |
| InChI | InChI=1S/C36H46F8N2O8/c1-8-9-10-11-22-12-15-25(27(16-22)48-7)28-17-23-13-14-24(18-26(23)51-28)49-20-33(37,38)52-35(41,42)54-36(43,44)53-34(39,40)21-50-29(47)31(4,5)32(6,46)19-30(2,3)45/h12-18H,8-11,19-21,45-46H2,1-7H3 |
| InChIKey | QWVZRQHXYGPAMQ-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 137.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.75 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|