C30H36F6N2O7 — CID 162608853
[3-[[1,1-difluoro-3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2,3-diaminopropanoate (PubChem CID 162608853) has the molecular formula C30H36F6N2O7 and a molecular weight of 650.61 g/mol. Its IUPAC name is [3-[[1,1-difluoro-3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2,3-diaminopropanoate.
| Compound Name | [3-[[1,1-difluoro-3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 162608853 |
| Molecular Formula | C30H36F6N2O7 |
| Molecular Weight | 650.61 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | [3-[[1,1-difluoro-3-[[2-(2-methoxy-4-pentylphenyl)-1-benzofuran-6-yl]oxy]propoxy]-difluoromethoxy]-3,3-difluoropropyl] 2,3-diaminopropanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCC(F)(F)OC(F)(F)OC(F)(F)CCOC(=O)C(N)CN)cc3o2)c(OC)c1 |
| InChI | InChI=1S/C30H36F6N2O7/c1-3-4-5-6-19-7-10-22(25(15-19)40-2)26-16-20-8-9-21(17-24(20)43-26)41-13-11-28(31,32)44-30(35,36)45-29(33,34)12-14-42-27(39)23(38)18-37/h7-10,15-17,23H,3-6,11-14,18,37-38H2,1-2H3 |
| InChIKey | NCQPSNNZMCINQF-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 128.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.61 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|