C27H35F2N3O4 — CID 162608927
[7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate (PubChem CID 162608927) has the molecular formula C27H35F2N3O4 and a molecular weight of 503.59 g/mol. Its IUPAC name is [7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate.
| Compound Name | [7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate |
|---|---|
| PubChem CID | 162608927 |
| Molecular Formula | C27H35F2N3O4 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | [7-[[2-(2,6-diethyl-3-pyridinyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2,3-diaminopropanoate |
| SMILES | CCc1ccc(-c2cc3ccc(OCCCC(F)(F)CCCOC(=O)C(N)CN)cc3o2)c(CC)n1 |
| InChI | InChI=1S/C27H35F2N3O4/c1-3-19-8-10-21(23(4-2)32-19)25-15-18-7-9-20(16-24(18)36-25)34-13-5-11-27(28,29)12-6-14-35-26(33)22(31)17-30/h7-10,15-16,22H,3-6,11-14,17,30-31H2,1-2H3 |
| InChIKey | OSODDDPMSWZOFW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|