C39H58O6 — CID 155238766
[8-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,5-dihydroxyoctyl] 4,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 155238766) has the molecular formula C39H58O6 and a molecular weight of 622.89 g/mol. Its IUPAC name is [8-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,5-dihydroxyoctyl] 4,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [8-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,5-dihydroxyoctyl] 4,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 155238766 |
| Molecular Formula | C39H58O6 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.42 |
| IUPAC Name | [8-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,5-dihydroxyoctyl] 4,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CCCCCc1ccc(-c2cc3ccc(OCCCC(O)C(O)CCCOC(=O)C(CC(C)(C)C)C(C)C)cc3o2)c(CC)c1 |
| InChI | InChI=1S/C39H58O6/c1-8-10-11-14-28-17-20-32(29(9-2)23-28)37-24-30-18-19-31(25-36(30)45-37)43-21-12-15-34(40)35(41)16-13-22-44-38(42)33(27(3)4)26-39(5,6)7/h17-20,23-25,27,33-35,40-41H,8-16,21-22,26H2,1-7H3 |
| InChIKey | HCLPAKHXLWQGGJ-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|