C30H35F3O7 — CID 155238553
[4,5-dihydroxy-8-[[2-[4-(3-hydroxypropyl)-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate (PubChem CID 155238553) has the molecular formula C30H35F3O7 and a molecular weight of 564.60 g/mol. Its IUPAC name is [4,5-dihydroxy-8-[[2-[4-(3-hydroxypropyl)-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate.
| Compound Name | [4,5-dihydroxy-8-[[2-[4-(3-hydroxypropyl)-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155238553 |
| Molecular Formula | C30H35F3O7 |
| Molecular Weight | 564.60 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | [4,5-dihydroxy-8-[[2-[4-(3-hydroxypropyl)-2-(trifluoromethyl)phenyl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(O)C(O)CCCOc1ccc2cc(-c3ccc(CCCO)cc3C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C30H35F3O7/c1-19(2)29(37)39-15-5-8-26(36)25(35)7-4-14-38-22-11-10-21-17-28(40-27(21)18-22)23-12-9-20(6-3-13-34)16-24(23)30(31,32)33/h9-12,16-18,25-26,34-36H,1,3-8,13-15H2,2H3 |
| InChIKey | CNMOSVGFKGDOJG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|