C28H33F3O8S — CID 155238546
[4,5-dihydroxy-8-[[2-[5-(3-hydroxypropyl)-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate (PubChem CID 155238546) has the molecular formula C28H33F3O8S and a molecular weight of 586.63 g/mol. Its IUPAC name is [4,5-dihydroxy-8-[[2-[5-(3-hydroxypropyl)-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate.
| Compound Name | [4,5-dihydroxy-8-[[2-[5-(3-hydroxypropyl)-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155238546 |
| Molecular Formula | C28H33F3O8S |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | [4,5-dihydroxy-8-[[2-[5-(3-hydroxypropyl)-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-yl]oxy]octyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(O)C(O)CCCOc1ccc2cc(-c3sc(CCCO)cc3OC(F)(F)F)oc2c1 |
| InChI | InChI=1S/C28H33F3O8S/c1-17(2)27(35)37-13-5-8-22(34)21(33)7-4-12-36-19-10-9-18-14-24(38-23(18)15-19)26-25(39-28(29,30)31)16-20(40-26)6-3-11-32/h9-10,14-16,21-22,32-34H,1,3-8,11-13H2,2H3 |
| InChIKey | BMKORIKEFNTLQG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 118.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|