C23H23F3O4S — CID 153303464
[2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxymethyl 2-methylprop-2-enoate (PubChem CID 153303464) has the molecular formula C23H23F3O4S and a molecular weight of 452.49 g/mol. Its IUPAC name is [2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxymethyl 2-methylprop-2-enoate.
| Compound Name | [2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxymethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153303464 |
| Molecular Formula | C23H23F3O4S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | [2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran-6-yl]oxymethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOc1ccc2cc(-c3sc(CCCCC)cc3C(F)(F)F)oc2c1 |
| InChI | InChI=1S/C23H23F3O4S/c1-4-5-6-7-17-12-18(23(24,25)26)21(31-17)20-10-15-8-9-16(11-19(15)30-20)28-13-29-22(27)14(2)3/h8-12H,2,4-7,13H2,1,3H3 |
| InChIKey | XSOHYQIQNICTLQ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|