C20H21F3O2S — CID 146722245
6-ethoxy-2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran (PubChem CID 146722245) has the molecular formula C20H21F3O2S and a molecular weight of 382.45 g/mol. Its IUPAC name is 6-ethoxy-2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran.
| Compound Name | 6-ethoxy-2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran |
|---|---|
| PubChem CID | 146722245 |
| Molecular Formula | C20H21F3O2S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 6-ethoxy-2-[5-pentyl-3-(trifluoromethyl)thiophen-2-yl]-1-benzofuran |
| SMILES | CCCCCc1cc(C(F)(F)F)c(-c2cc3ccc(OCC)cc3o2)s1 |
| InChI | InChI=1S/C20H21F3O2S/c1-3-5-6-7-15-12-16(20(21,22)23)19(26-15)18-10-13-8-9-14(24-4-2)11-17(13)25-18/h8-12H,3-7H2,1-2H3 |
| InChIKey | RFFDUAKGRLYYTE-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 22.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|