C18H17F3O2S2 — CID 166777110
2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-thiol (PubChem CID 166777110) has the molecular formula C18H17F3O2S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-thiol.
| Compound Name | 2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-thiol |
|---|---|
| PubChem CID | 166777110 |
| Molecular Formula | C18H17F3O2S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 2-[5-pentyl-3-(trifluoromethoxy)thiophen-2-yl]-1-benzofuran-6-thiol |
| SMILES | CCCCCc1cc(OC(F)(F)F)c(-c2cc3ccc(S)cc3o2)s1 |
| InChI | InChI=1S/C18H17F3O2S2/c1-2-3-4-5-13-10-16(23-18(19,20)21)17(25-13)15-8-11-6-7-12(24)9-14(11)22-15/h6-10,24H,2-5H2,1H3 |
| InChIKey | FZTAFLYSHUCUJG-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 22.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|