C29H30F6O5 — CID 146390674
[3,3,3-trifluoro-2-methyl-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 2-methylprop-2-enoate (PubChem CID 146390674) has the molecular formula C29H30F6O5 and a molecular weight of 572.54 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-methyl-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-methyl-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390674 |
| Molecular Formula | C29H30F6O5 |
| Molecular Weight | 572.54 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | [3,3,3-trifluoro-2-methyl-2-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxymethyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(COc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C29H30F6O5/c1-5-6-7-8-19-9-12-22(25(13-19)40-29(33,34)35)24-14-20-10-11-21(15-23(20)39-24)37-16-27(4,28(30,31)32)17-38-26(36)18(2)3/h9-15H,2,5-8,16-17H2,1,3-4H3 |
| InChIKey | WYQMRZKGOXNAMX-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 57.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.54 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|