C32H39F3O9 — CID 155005032
[2-hydroxy-3-[2-[2-hydroxy-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]propoxy]ethoxy]propyl] 2-methylprop-2-enoate (PubChem CID 155005032) has the molecular formula C32H39F3O9 and a molecular weight of 624.65 g/mol. Its IUPAC name is [2-hydroxy-3-[2-[2-hydroxy-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]propoxy]ethoxy]propyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[2-[2-hydroxy-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]propoxy]ethoxy]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155005032 |
| Molecular Formula | C32H39F3O9 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | [2-hydroxy-3-[2-[2-hydroxy-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzofuran-6-yl]oxy]propoxy]ethoxy]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COCCOCC(O)COc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)oc2c1 |
| InChI | InChI=1S/C32H39F3O9/c1-4-5-6-7-22-8-11-27(30(14-22)44-32(33,34)35)29-15-23-9-10-26(16-28(23)43-29)41-19-24(36)17-39-12-13-40-18-25(37)20-42-31(38)21(2)3/h8-11,14-16,24-25,36-37H,2,4-7,12-13,17-20H2,1,3H3 |
| InChIKey | FJFVYQMKHWFDCM-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|