C32H40F2O4 — CID 146390592
[7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate (PubChem CID 146390592) has the molecular formula C32H40F2O4 and a molecular weight of 526.66 g/mol. Its IUPAC name is [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate.
| Compound Name | [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146390592 |
| Molecular Formula | C32H40F2O4 |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.29 |
| IUPAC Name | [7-[[2-(2-ethyl-4-pentylphenyl)-1-benzofuran-6-yl]oxy]-4,4-difluoroheptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(F)(F)CCCOc1ccc2cc(-c3ccc(CCCCC)cc3CC)oc2c1 |
| InChI | InChI=1S/C32H40F2O4/c1-5-7-8-11-24-12-15-28(25(6-2)20-24)30-21-26-13-14-27(22-29(26)38-30)36-18-9-16-32(33,34)17-10-19-37-31(35)23(3)4/h12-15,20-22H,3,5-11,16-19H2,1-2,4H3 |
| InChIKey | VAZTZWGTMSSVGX-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|