C33H34F8O5 — CID 162061589
[3,3,4,4,5,5,6,6-octafluoro-8-[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxyoctyl] 2-methylprop-2-enoate (PubChem CID 162061589) has the molecular formula C33H34F8O5 and a molecular weight of 662.61 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxyoctyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxyoctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 162061589 |
| Molecular Formula | C33H34F8O5 |
| Molecular Weight | 662.61 g/mol |
| Exact Mass | 662.23 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[3-(2-methyl-4-pentylphenyl)-2-oxochromen-7-yl]oxyoctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3C)c(=O)oc2c1 |
| InChI | InChI=1S/C33H34F8O5/c1-5-6-7-8-22-9-12-25(21(4)17-22)26-18-23-10-11-24(19-27(23)46-29(26)43)44-15-13-30(34,35)32(38,39)33(40,41)31(36,37)14-16-45-28(42)20(2)3/h9-12,17-19H,2,5-8,13-16H2,1,3-4H3 |
| InChIKey | CCJROGBQTGLYIF-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.61 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|