C36H40F11NO4 — CID 146391127
[3,3,4,4,5,5,6,6-octafluoro-8-[1-(2-methylpropyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxyoctyl] 2-methylprop-2-enoate (PubChem CID 146391127) has the molecular formula C36H40F11NO4 and a molecular weight of 759.70 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6-octafluoro-8-[1-(2-methylpropyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxyoctyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6-octafluoro-8-[1-(2-methylpropyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxyoctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146391127 |
| Molecular Formula | C36H40F11NO4 |
| Molecular Weight | 759.70 g/mol |
| Exact Mass | 759.28 |
| IUPAC Name | [3,3,4,4,5,5,6,6-octafluoro-8-[1-(2-methylpropyl)-2-[4-pentyl-2-(trifluoromethoxy)phenyl]indol-6-yl]oxyoctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)CCOc1ccc2cc(-c3ccc(CCCCC)cc3OC(F)(F)F)n(CC(C)C)c2c1 |
| InChI | InChI=1S/C36H40F11NO4/c1-6-7-8-9-24-10-13-27(30(18-24)52-36(45,46)47)29-19-25-11-12-26(20-28(25)48(29)21-22(2)3)50-16-14-32(37,38)34(41,42)35(43,44)33(39,40)15-17-51-31(49)23(4)5/h10-13,18-20,22H,4,6-9,14-17,21H2,1-3,5H3 |
| InChIKey | BXUSLWSEGGBGHL-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.70 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|