C28H35NO5 — CID 154601517
[2-hydroxy-3-[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxypropyl] 2-methylprop-2-enoate (PubChem CID 154601517) has the molecular formula C28H35NO5 and a molecular weight of 465.59 g/mol. Its IUPAC name is [2-hydroxy-3-[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxypropyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-3-[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxypropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154601517 |
| Molecular Formula | C28H35NO5 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | [2-hydroxy-3-[2-(2-methoxy-4-pentylphenyl)-1-methylindol-6-yl]oxypropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)n(C)c2c1 |
| InChI | InChI=1S/C28H35NO5/c1-6-7-8-9-20-10-13-24(27(14-20)32-5)26-15-21-11-12-23(16-25(21)29(26)4)33-17-22(30)18-34-28(31)19(2)3/h10-16,22,30H,2,6-9,17-18H2,1,3-5H3 |
| InChIKey | APDJPAADZBMARR-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|