C29H36O4S — CID 158720889
[3-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate (PubChem CID 158720889) has the molecular formula C29H36O4S and a molecular weight of 480.67 g/mol. Its IUPAC name is [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate.
| Compound Name | [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158720889 |
| Molecular Formula | C29H36O4S |
| Molecular Weight | 480.67 g/mol |
| Exact Mass | 480.23 |
| IUPAC Name | [3-[[2-(2-methoxy-4-pentylphenyl)-1-benzothiophen-6-yl]oxy]-2,2-dimethylpropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(C)(C)COc1ccc2cc(-c3ccc(CCCCC)cc3OC)sc2c1 |
| InChI | InChI=1S/C29H36O4S/c1-7-8-9-10-21-11-14-24(25(15-21)31-6)27-16-22-12-13-23(17-26(22)34-27)32-18-29(4,5)19-33-28(30)20(2)3/h11-17H,2,7-10,18-19H2,1,3-6H3 |
| InChIKey | PLYAZCAOEVPJEM-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.67 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|