C31H32F6O4S — CID 146391077
[2-methyl-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzothiophen-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 146391077) has the molecular formula C31H32F6O4S and a molecular weight of 614.65 g/mol. Its IUPAC name is [2-methyl-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzothiophen-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [2-methyl-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzothiophen-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 146391077 |
| Molecular Formula | C31H32F6O4S |
| Molecular Weight | 614.65 g/mol |
| Exact Mass | 614.19 |
| IUPAC Name | [2-methyl-3-[[2-[4-pentyl-2-(trifluoromethoxy)phenyl]-1-benzothiophen-6-yl]oxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(Oc2ccc3cc(-c4ccc(CCCCC)cc4OC(F)(F)F)sc3c2)C1(C)C(F)(F)F |
| InChI | InChI=1S/C31H32F6O4S/c1-5-6-7-8-19-9-12-22(23(15-19)41-31(35,36)37)25-16-20-10-11-21(17-24(20)42-25)39-26-13-14-27(40-28(38)18(2)3)29(26,4)30(32,33)34/h9-12,15-17,26-27H,2,5-8,13-14H2,1,3-4H3 |
| InChIKey | ZEBLJSOSHLAJRM-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.65 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|