C55H53F9O11 — CID 153454769
[3-[1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 153454769) has the molecular formula C55H53F9O11 and a molecular weight of 1061.00 g/mol. Its IUPAC name is [3-[1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [3-[1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153454769 |
| Molecular Formula | C55H53F9O11 |
| Molecular Weight | 1061.00 g/mol |
| Exact Mass | 1060.34 |
| IUPAC Name | [3-[1,3-bis[[2-oxo-3-[4-pentyl-2-(trifluoromethoxy)phenyl]chromen-7-yl]oxy]propan-2-yloxy]-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(OC(COc2ccc3cc(-c4ccc(CCCCC)cc4OC(F)(F)F)c(=O)oc3c2)COc2ccc3cc(-c4ccc(CCCCC)cc4OC(F)(F)F)c(=O)oc3c2)C1C(F)(F)F |
| InChI | InChI=1S/C55H53F9O11/c1-5-7-9-11-32-13-19-39(47(23-32)74-54(59,60)61)41-25-34-15-17-36(27-45(34)72-51(41)66)68-29-38(70-43-21-22-44(49(43)53(56,57)58)71-50(65)31(3)4)30-69-37-18-16-35-26-42(52(67)73-46(35)28-37)40-20-14-33(12-10-8-6-2)24-48(40)75-55(62,63)64/h13-20,23-28,38,43-44,49H,3,5-12,21-22,29-30H2,1-2,4H3 |
| InChIKey | CMAXGZBMLSMLND-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 132.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1061.00 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|