C27H22F6O7 — CID 155262421
[3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate (PubChem CID 155262421) has the molecular formula C27H22F6O7 and a molecular weight of 572.45 g/mol. Its IUPAC name is [3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate.
| Compound Name | [3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155262421 |
| Molecular Formula | C27H22F6O7 |
| Molecular Weight | 572.45 g/mol |
| Exact Mass | 572.13 |
| IUPAC Name | [3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-(trifluoromethyl)cyclopentyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCC(Oc2ccc3cc(-c4ccc(OC)cc4OC(F)(F)F)c(=O)oc3c2)C1C(F)(F)F |
| InChI | InChI=1S/C27H22F6O7/c1-13(2)24(34)38-20-9-8-19(23(20)26(28,29)30)37-16-5-4-14-10-18(25(35)39-21(14)12-16)17-7-6-15(36-3)11-22(17)40-27(31,32)33/h4-7,10-12,19-20,23H,1,8-9H2,2-3H3 |
| InChIKey | IPVUJQRWMCCGQH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.45 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|