C24H21F3O7 — CID 170017631
[3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-methylpropyl] prop-2-enoate (PubChem CID 170017631) has the molecular formula C24H21F3O7 and a molecular weight of 478.42 g/mol. Its IUPAC name is [3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-methylpropyl] prop-2-enoate.
| Compound Name | [3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-methylpropyl] prop-2-enoate |
|---|---|
| PubChem CID | 170017631 |
| Molecular Formula | C24H21F3O7 |
| Molecular Weight | 478.42 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [3-[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxy-2-methylpropyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(C)COc1ccc2cc(-c3ccc(OC)cc3OC(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C24H21F3O7/c1-4-22(28)32-13-14(2)12-31-17-6-5-15-9-19(23(29)33-20(15)11-17)18-8-7-16(30-3)10-21(18)34-24(25,26)27/h4-11,14H,1,12-13H2,2-3H3 |
| InChIKey | LAWIDUJDQTXUFQ-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|