C25H20F6O7 — CID 155262358
[3,3,3-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]propyl] 2-methylprop-2-enoate (PubChem CID 155262358) has the molecular formula C25H20F6O7 and a molecular weight of 546.42 g/mol. Its IUPAC name is [3,3,3-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]propyl] 2-methylprop-2-enoate.
| Compound Name | [3,3,3-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]propyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155262358 |
| Molecular Formula | C25H20F6O7 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | [3,3,3-trifluoro-2-[[3-[4-methoxy-2-(trifluoromethoxy)phenyl]-2-oxochromen-7-yl]oxymethyl]propyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COc1ccc2cc(-c3ccc(OC)cc3OC(F)(F)F)c(=O)oc2c1)C(F)(F)F |
| InChI | InChI=1S/C25H20F6O7/c1-13(2)22(32)36-12-15(24(26,27)28)11-35-17-5-4-14-8-19(23(33)37-20(14)10-17)18-7-6-16(34-3)9-21(18)38-25(29,30)31/h4-10,15H,1,11-12H2,2-3H3 |
| InChIKey | IAOISPJLDCNODW-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|