C30H33F3O6 — CID 153306106
[4,4,4-trifluoro-2-[[3-(2-methoxy-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] 2-methylprop-2-enoate (PubChem CID 153306106) has the molecular formula C30H33F3O6 and a molecular weight of 546.58 g/mol. Its IUPAC name is [4,4,4-trifluoro-2-[[3-(2-methoxy-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] 2-methylprop-2-enoate.
| Compound Name | [4,4,4-trifluoro-2-[[3-(2-methoxy-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 153306106 |
| Molecular Formula | C30H33F3O6 |
| Molecular Weight | 546.58 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | [4,4,4-trifluoro-2-[[3-(2-methoxy-4-pentylphenyl)-2-oxochromen-7-yl]oxymethyl]butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(COc1ccc2cc(-c3ccc(CCCCC)cc3OC)c(=O)oc2c1)CC(F)(F)F |
| InChI | InChI=1S/C30H33F3O6/c1-5-6-7-8-20-9-12-24(27(13-20)36-4)25-14-22-10-11-23(15-26(22)39-29(25)35)37-17-21(16-30(31,32)33)18-38-28(34)19(2)3/h9-15,21H,2,5-8,16-18H2,1,3-4H3 |
| InChIKey | CRXQQSSHQQSEOD-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.58 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|