C21H22O4 — CID 146412159
7-hydroxy-3-(2-methoxy-4-pentylphenyl)chromen-2-one (PubChem CID 146412159) has the molecular formula C21H22O4 and a molecular weight of 338.40 g/mol. Its IUPAC name is 7-hydroxy-3-(2-methoxy-4-pentylphenyl)chromen-2-one.
| Compound Name | 7-hydroxy-3-(2-methoxy-4-pentylphenyl)chromen-2-one |
|---|---|
| PubChem CID | 146412159 |
| Molecular Formula | C21H22O4 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 7-hydroxy-3-(2-methoxy-4-pentylphenyl)chromen-2-one |
| SMILES | CCCCCc1ccc(-c2cc3ccc(O)cc3oc2=O)c(OC)c1 |
| InChI | InChI=1S/C21H22O4/c1-3-4-5-6-14-7-10-17(20(11-14)24-2)18-12-15-8-9-16(22)13-19(15)25-21(18)23/h7-13,22H,3-6H2,1-2H3 |
| InChIKey | MBYRWTOJEMYYDJ-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|