C18H13F3O4 — CID 138735929
3-[4-ethyl-2-(trifluoromethoxy)phenyl]-7-hydroxychromen-2-one (PubChem CID 138735929) has the molecular formula C18H13F3O4 and a molecular weight of 350.29 g/mol. Its IUPAC name is 3-[4-ethyl-2-(trifluoromethoxy)phenyl]-7-hydroxychromen-2-one.
| Compound Name | 3-[4-ethyl-2-(trifluoromethoxy)phenyl]-7-hydroxychromen-2-one |
|---|---|
| PubChem CID | 138735929 |
| Molecular Formula | C18H13F3O4 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 3-[4-ethyl-2-(trifluoromethoxy)phenyl]-7-hydroxychromen-2-one |
| SMILES | CCc1ccc(-c2cc3ccc(O)cc3oc2=O)c(OC(F)(F)F)c1 |
| InChI | InChI=1S/C18H13F3O4/c1-2-10-3-6-13(16(7-10)25-18(19,20)21)14-8-11-4-5-12(22)9-15(11)24-17(14)23/h3-9,22H,2H2,1H3 |
| InChIKey | AYYCWHFSPCSBMG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|