About 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one
3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one (PubChem CID 145263250) has the molecular formula C20H17F3O4
and a molecular weight of 378.35 g/mol. Its IUPAC name is 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one.
Molecular Properties
| Compound Name | 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one |
| PubChem CID | 145263250 |
| Molecular Formula | C20H17F3O4 |
| Molecular Weight | 378.35 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one |
| SMILES | CC(C)=O.Cc1ccc2cc(-c3ccc(O)cc3C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C17H11F3O3.C3H6O/c1-9-2-3-10-7-13(16(22)23-15(10)6-9)12-5-4-11(21)8-14(12)17(18,19)20;1-3(2)4/h2-8,21H,1H3;1-2H3 |
| InChIKey | OLQYIHVJBYNUPX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.35 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one?
The IUPAC name of 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one (CID 145263250) is 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one.
What is the SMILES notation for 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one?
The canonical SMILES for 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one is CC(C)=O.Cc1ccc2cc(-c3ccc(O)cc3C(F)(F)F)c(=O)oc2c1.
What is the InChIKey of 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one?
The InChIKey is OLQYIHVJBYNUPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11F3O3.C3H6O/c1-9-2-3-10-7-13(16(22)23-15(10)6-9)12-5-4-11(21)8-14(12)17(18,19)20;1-3(2)4/h2-8,21H,1H3;1-2H3.
What are the key properties of 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one?
3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one has a molecular weight of 378.35 g/mol, XLogP of 5.09, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-hydroxy-2-(trifluoromethyl)phenyl]-7-methylchromen-2-one;propan-2-one is sourced from PubChem (CID 145263250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).