C17H14O6 — CID 71722134
7-hydroxy-3-(3-hydroxy-2,4-dimethoxyphenyl)chromen-2-one (PubChem CID 71722134) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is 7-hydroxy-3-(3-hydroxy-2,4-dimethoxyphenyl)chromen-2-one.
| Compound Name | 7-hydroxy-3-(3-hydroxy-2,4-dimethoxyphenyl)chromen-2-one |
|---|---|
| PubChem CID | 71722134 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 7-hydroxy-3-(3-hydroxy-2,4-dimethoxyphenyl)chromen-2-one |
| SMILES | COc1ccc(-c2cc3ccc(O)cc3oc2=O)c(OC)c1O |
| InChI | InChI=1S/C17H14O6/c1-21-13-6-5-11(16(22-2)15(13)19)12-7-9-3-4-10(18)8-14(9)23-17(12)20/h3-8,18-19H,1-2H3 |
| InChIKey | YXCOKWRIGBHNPD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|