C16H18O6 — CID 53362757
3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dimethoxyphenol (PubChem CID 53362757) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dimethoxyphenol.
| Compound Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 53362757 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 3-(4-hydroxy-3,5-dimethoxyphenyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(-c2ccc(OC)c(O)c2OC)cc(OC)c1O |
| InChI | InChI=1S/C16H18O6/c1-19-11-6-5-10(16(22-4)15(11)18)9-7-12(20-2)14(17)13(8-9)21-3/h5-8,17-18H,1-4H3 |
| InChIKey | PZSVCVKTECUJCN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |