C19H18O8 — CID 163192768
4-hydroxy-2-(3-hydroxy-2,4-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran-3-carbaldehyde (PubChem CID 163192768) has the molecular formula C19H18O8 and a molecular weight of 374.35 g/mol. Its IUPAC name is 4-hydroxy-2-(3-hydroxy-2,4-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran-3-carbaldehyde.
| Compound Name | 4-hydroxy-2-(3-hydroxy-2,4-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 163192768 |
| Molecular Formula | C19H18O8 |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 4-hydroxy-2-(3-hydroxy-2,4-dimethoxyphenyl)-5,7-dimethoxy-1-benzofuran-3-carbaldehyde |
| SMILES | COc1ccc(-c2oc3c(OC)cc(OC)c(O)c3c2C=O)c(OC)c1O |
| InChI | InChI=1S/C19H18O8/c1-23-11-6-5-9(18(26-4)16(11)22)17-10(8-20)14-15(21)12(24-2)7-13(25-3)19(14)27-17/h5-8,21-22H,1-4H3 |
| InChIKey | JQDIPQFEGFTAES-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|