C15H17NO3 — CID 174720753
4-(5-amino-2-methylphenyl)-2,6-dimethoxyphenol (PubChem CID 174720753) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-(5-amino-2-methylphenyl)-2,6-dimethoxyphenol.
| Compound Name | 4-(5-amino-2-methylphenyl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 174720753 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-(5-amino-2-methylphenyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(-c2cc(N)ccc2C)cc(OC)c1O |
| InChI | InChI=1S/C15H17NO3/c1-9-4-5-11(16)8-12(9)10-6-13(18-2)15(17)14(7-10)19-3/h4-8,17H,16H2,1-3H3 |
| InChIKey | DGZQDKWZJHUHLT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|