About ethane;methane;3-methoxy-4-methylaniline
ethane;methane;3-methoxy-4-methylaniline (PubChem CID 144516222) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is ethane;methane;3-methoxy-4-methylaniline.
Molecular Properties
| Compound Name | ethane;methane;3-methoxy-4-methylaniline |
| PubChem CID | 144516222 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | ethane;methane;3-methoxy-4-methylaniline |
| SMILES | C.CC.COc1cc(N)ccc1C |
| InChI | InChI=1S/C8H11NO.C2H6.CH4/c1-6-3-4-7(9)5-8(6)10-2;1-2;/h3-5H,9H2,1-2H3;1-2H3;1H4 |
| InChIKey | LWEFFEVEOQMBEG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;3-methoxy-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;3-methoxy-4-methylaniline?
The IUPAC name of ethane;methane;3-methoxy-4-methylaniline (CID 144516222) is ethane;methane;3-methoxy-4-methylaniline.
What is the SMILES notation for ethane;methane;3-methoxy-4-methylaniline?
The canonical SMILES for ethane;methane;3-methoxy-4-methylaniline is C.CC.COc1cc(N)ccc1C.
What is the InChIKey of ethane;methane;3-methoxy-4-methylaniline?
The InChIKey is LWEFFEVEOQMBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO.C2H6.CH4/c1-6-3-4-7(9)5-8(6)10-2;1-2;/h3-5H,9H2,1-2H3;1-2H3;1H4.
What are the key properties of ethane;methane;3-methoxy-4-methylaniline?
ethane;methane;3-methoxy-4-methylaniline has a molecular weight of 183.29 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;3-methoxy-4-methylaniline is sourced from PubChem (CID 144516222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).