About 4-bromo-3-methoxyaniline;iron
4-bromo-3-methoxyaniline;iron (PubChem CID 158491783) has the molecular formula C7H8BrFeNO
and a molecular weight of 257.90 g/mol. Its IUPAC name is 4-bromo-3-methoxyaniline;iron.
Molecular Properties
| Compound Name | 4-bromo-3-methoxyaniline;iron |
| PubChem CID | 158491783 |
| Molecular Formula | C7H8BrFeNO |
| Molecular Weight | 257.90 g/mol |
| Exact Mass | 256.91 |
| IUPAC Name | 4-bromo-3-methoxyaniline;iron |
| SMILES | COc1cc(N)ccc1Br.[Fe] |
| InChI | InChI=1S/C7H8BrNO.Fe/c1-10-7-4-5(9)2-3-6(7)8;/h2-4H,9H2,1H3; |
| InChIKey | HIUBTWIGXXUXST-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.90 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-3-methoxyaniline;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-3-methoxyaniline;iron?
The IUPAC name of 4-bromo-3-methoxyaniline;iron (CID 158491783) is 4-bromo-3-methoxyaniline;iron.
What is the SMILES notation for 4-bromo-3-methoxyaniline;iron?
The canonical SMILES for 4-bromo-3-methoxyaniline;iron is COc1cc(N)ccc1Br.[Fe].
What is the InChIKey of 4-bromo-3-methoxyaniline;iron?
The InChIKey is HIUBTWIGXXUXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrNO.Fe/c1-10-7-4-5(9)2-3-6(7)8;/h2-4H,9H2,1H3;.
What are the key properties of 4-bromo-3-methoxyaniline;iron?
4-bromo-3-methoxyaniline;iron has a molecular weight of 257.90 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-3-methoxyaniline;iron is sourced from PubChem (CID 158491783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).