C7H9BrN2O — CID 10889334
2-bromo-6-methoxybenzene-1,4-diamine (PubChem CID 10889334) has the molecular formula C7H9BrN2O and a molecular weight of 217.07 g/mol. Its IUPAC name is 2-bromo-6-methoxybenzene-1,4-diamine.
| Compound Name | 2-bromo-6-methoxybenzene-1,4-diamine |
|---|---|
| PubChem CID | 10889334 |
| Molecular Formula | C7H9BrN2O |
| Molecular Weight | 217.07 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | 2-bromo-6-methoxybenzene-1,4-diamine |
| SMILES | COc1cc(N)cc(Br)c1N |
| InChI | InChI=1S/C7H9BrN2O/c1-11-6-3-4(9)2-5(8)7(6)10/h2-3H,9-10H2,1H3 |
| InChIKey | ICPJHGIIFZSCON-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.07 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|