About 6-bromo-3-chloro-2,4-dimethoxyaniline
6-bromo-3-chloro-2,4-dimethoxyaniline (PubChem CID 58946772) has the molecular formula C8H9BrClNO2
and a molecular weight of 266.52 g/mol. Its IUPAC name is 6-bromo-3-chloro-2,4-dimethoxyaniline.
Molecular Properties
| Compound Name | 6-bromo-3-chloro-2,4-dimethoxyaniline |
| PubChem CID | 58946772 |
| Molecular Formula | C8H9BrClNO2 |
| Molecular Weight | 266.52 g/mol |
| Exact Mass | 264.95 |
| IUPAC Name | 6-bromo-3-chloro-2,4-dimethoxyaniline |
| SMILES | COc1cc(Br)c(N)c(OC)c1Cl |
| InChI | InChI=1S/C8H9BrClNO2/c1-12-5-3-4(9)7(11)8(13-2)6(5)10/h3H,11H2,1-2H3 |
| InChIKey | NWYPWBGLOYMVKA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-chloro-2,4-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-chloro-2,4-dimethoxyaniline?
The IUPAC name of 6-bromo-3-chloro-2,4-dimethoxyaniline (CID 58946772) is 6-bromo-3-chloro-2,4-dimethoxyaniline.
What is the SMILES notation for 6-bromo-3-chloro-2,4-dimethoxyaniline?
The canonical SMILES for 6-bromo-3-chloro-2,4-dimethoxyaniline is COc1cc(Br)c(N)c(OC)c1Cl.
What is the InChIKey of 6-bromo-3-chloro-2,4-dimethoxyaniline?
The InChIKey is NWYPWBGLOYMVKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrClNO2/c1-12-5-3-4(9)7(11)8(13-2)6(5)10/h3H,11H2,1-2H3.
What are the key properties of 6-bromo-3-chloro-2,4-dimethoxyaniline?
6-bromo-3-chloro-2,4-dimethoxyaniline has a molecular weight of 266.52 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-chloro-2,4-dimethoxyaniline is sourced from PubChem (CID 58946772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).