C11H9BrClNO2 — CID 102941242
2-bromo-5-chloro-6,8-dimethoxyquinoline (PubChem CID 102941242) has the molecular formula C11H9BrClNO2 and a molecular weight of 302.56 g/mol. Its IUPAC name is 2-bromo-5-chloro-6,8-dimethoxyquinoline.
| Compound Name | 2-bromo-5-chloro-6,8-dimethoxyquinoline |
|---|---|
| PubChem CID | 102941242 |
| Molecular Formula | C11H9BrClNO2 |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 300.95 |
| IUPAC Name | 2-bromo-5-chloro-6,8-dimethoxyquinoline |
| SMILES | COc1cc(OC)c2nc(Br)ccc2c1Cl |
| InChI | InChI=1S/C11H9BrClNO2/c1-15-7-5-8(16-2)11-6(10(7)13)3-4-9(12)14-11/h3-5H,1-2H3 |
| InChIKey | NPFLFHVPPIOTKU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|