C10H6Br2ClN — CID 102941285
2,8-dibromo-5-chloro-6-methylquinoline (PubChem CID 102941285) has the molecular formula C10H6Br2ClN and a molecular weight of 335.43 g/mol. Its IUPAC name is 2,8-dibromo-5-chloro-6-methylquinoline.
| Compound Name | 2,8-dibromo-5-chloro-6-methylquinoline |
|---|---|
| PubChem CID | 102941285 |
| Molecular Formula | C10H6Br2ClN |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 332.86 |
| IUPAC Name | 2,8-dibromo-5-chloro-6-methylquinoline |
| SMILES | Cc1cc(Br)c2nc(Br)ccc2c1Cl |
| InChI | InChI=1S/C10H6Br2ClN/c1-5-4-7(11)10-6(9(5)13)2-3-8(12)14-10/h2-4H,1H3 |
| InChIKey | QUZUZNJEOPGAAU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|