About 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine
5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine (PubChem CID 63525424) has the molecular formula C16H21ClN2O2
and a molecular weight of 308.81 g/mol. Its IUPAC name is 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine |
| PubChem CID | 63525424 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine |
| SMILES | CCNc1nc2c(OC)cc(OC)c(Cl)c2cc1C(C)C |
| InChI | InChI=1S/C16H21ClN2O2/c1-6-18-16-10(9(2)3)7-11-14(17)12(20-4)8-13(21-5)15(11)19-16/h7-9H,6H2,1-5H3,(H,18,19) |
| InChIKey | MXMCRXSPBXQZJN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine?
The IUPAC name of 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine (CID 63525424) is 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine.
What is the SMILES notation for 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine?
The canonical SMILES for 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine is CCNc1nc2c(OC)cc(OC)c(Cl)c2cc1C(C)C.
What is the InChIKey of 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine?
The InChIKey is MXMCRXSPBXQZJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClN2O2/c1-6-18-16-10(9(2)3)7-11-14(17)12(20-4)8-13(21-5)15(11)19-16/h7-9H,6H2,1-5H3,(H,18,19).
What are the key properties of 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine?
5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine has a molecular weight of 308.81 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine is sourced from PubChem (CID 63525424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).