C16H21ClN2O2 — CID 63525424
5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine (PubChem CID 63525424) has the molecular formula C16H21ClN2O2 and a molecular weight of 308.81 g/mol. Its IUPAC name is 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine.
| Compound Name | 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine |
|---|---|
| PubChem CID | 63525424 |
| Molecular Formula | C16H21ClN2O2 |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 5-chloro-N-ethyl-6,8-dimethoxy-3-propan-2-ylquinolin-2-amine |
| SMILES | CCNc1nc2c(OC)cc(OC)c(Cl)c2cc1C(C)C |
| InChI | InChI=1S/C16H21ClN2O2/c1-6-18-16-10(9(2)3)7-11-14(17)12(20-4)8-13(21-5)15(11)19-16/h7-9H,6H2,1-5H3,(H,18,19) |
| InChIKey | MXMCRXSPBXQZJN-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |