C10H15NO4 — CID 19093015
2,3,5,6-tetramethoxyaniline (PubChem CID 19093015) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2,3,5,6-tetramethoxyaniline.
| Compound Name | 2,3,5,6-tetramethoxyaniline |
|---|---|
| PubChem CID | 19093015 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 2,3,5,6-tetramethoxyaniline |
| SMILES | COc1cc(OC)c(OC)c(N)c1OC |
| InChI | InChI=1S/C10H15NO4/c1-12-6-5-7(13-2)10(15-4)8(11)9(6)14-3/h5H,11H2,1-4H3 |
| InChIKey | TUIFQKGWBZZWQJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|