C9H14N2O3 — CID 14975826
3,4,6-trimethoxybenzene-1,2-diamine (PubChem CID 14975826) has the molecular formula C9H14N2O3 and a molecular weight of 198.22 g/mol. Its IUPAC name is 3,4,6-trimethoxybenzene-1,2-diamine.
| Compound Name | 3,4,6-trimethoxybenzene-1,2-diamine |
|---|---|
| PubChem CID | 14975826 |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3,4,6-trimethoxybenzene-1,2-diamine |
| SMILES | COc1cc(OC)c(OC)c(N)c1N |
| InChI | InChI=1S/C9H14N2O3/c1-12-5-4-6(13-2)9(14-3)8(11)7(5)10/h4H,10-11H2,1-3H3 |
| InChIKey | PMAWLZIRCMASHG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|