C9H14N2O2 — CID 13006980
4,5-dimethoxy-3-methylbenzene-1,2-diamine (PubChem CID 13006980) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 4,5-dimethoxy-3-methylbenzene-1,2-diamine.
| Compound Name | 4,5-dimethoxy-3-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 13006980 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4,5-dimethoxy-3-methylbenzene-1,2-diamine |
| SMILES | COc1cc(N)c(N)c(C)c1OC |
| InChI | InChI=1S/C9H14N2O2/c1-5-8(11)6(10)4-7(12-2)9(5)13-3/h4H,10-11H2,1-3H3 |
| InChIKey | SYBHFRANGFCNMU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|