About 4,5-dimethoxy-3-methylbenzene-1,2-diamine
4,5-dimethoxy-3-methylbenzene-1,2-diamine (PubChem CID 13006980) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 4,5-dimethoxy-3-methylbenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4,5-dimethoxy-3-methylbenzene-1,2-diamine |
| PubChem CID | 13006980 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 4,5-dimethoxy-3-methylbenzene-1,2-diamine |
| SMILES | COc1cc(N)c(N)c(C)c1OC |
| InChI | InChI=1S/C9H14N2O2/c1-5-8(11)6(10)4-7(12-2)9(5)13-3/h4H,10-11H2,1-3H3 |
| InChIKey | SYBHFRANGFCNMU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethoxy-3-methylbenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethoxy-3-methylbenzene-1,2-diamine?
The IUPAC name of 4,5-dimethoxy-3-methylbenzene-1,2-diamine (CID 13006980) is 4,5-dimethoxy-3-methylbenzene-1,2-diamine.
What is the SMILES notation for 4,5-dimethoxy-3-methylbenzene-1,2-diamine?
The canonical SMILES for 4,5-dimethoxy-3-methylbenzene-1,2-diamine is COc1cc(N)c(N)c(C)c1OC.
What is the InChIKey of 4,5-dimethoxy-3-methylbenzene-1,2-diamine?
The InChIKey is SYBHFRANGFCNMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-5-8(11)6(10)4-7(12-2)9(5)13-3/h4H,10-11H2,1-3H3.
What are the key properties of 4,5-dimethoxy-3-methylbenzene-1,2-diamine?
4,5-dimethoxy-3-methylbenzene-1,2-diamine has a molecular weight of 182.22 g/mol, XLogP of 1.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethoxy-3-methylbenzene-1,2-diamine is sourced from PubChem (CID 13006980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).