C9H13NO2 — CID 14263216
2,3-dimethoxy-5-methylaniline (PubChem CID 14263216) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methylaniline.
| Compound Name | 2,3-dimethoxy-5-methylaniline |
|---|---|
| PubChem CID | 14263216 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 2,3-dimethoxy-5-methylaniline |
| SMILES | COc1cc(C)cc(N)c1OC |
| InChI | InChI=1S/C9H13NO2/c1-6-4-7(10)9(12-3)8(5-6)11-2/h4-5H,10H2,1-3H3 |
| InChIKey | HKEKKVOQQPLBMV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|