C25H20O5 — CID 102452050
2,5,8,11,20-pentamethoxyhexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene (PubChem CID 102452050) has the molecular formula C25H20O5 and a molecular weight of 400.43 g/mol. Its IUPAC name is 2,5,8,11,20-pentamethoxyhexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene.
| Compound Name | 2,5,8,11,20-pentamethoxyhexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene |
|---|---|
| PubChem CID | 102452050 |
| Molecular Formula | C25H20O5 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2,5,8,11,20-pentamethoxyhexacyclo[11.5.2.04,17.07,16.010,15.014,18]icosa-1(19),2,4(17),5,7,9,11,13(20),14(18),15-decaene |
| SMILES | COc1cc2c(OC)cc3c(OC)cc4c(OC)cc5c(OC)cc1c1c5c4c3c21 |
| InChI | InChI=1S/C25H20O5/c1-26-16-6-12-18(28-3)8-14-20(30-5)10-15-19(29-4)9-13-17(27-2)7-11(16)21-22(12)24(14)25(15)23(13)21/h6-10H,1-5H3 |
| InChIKey | JIYGZJGRQXXYRH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|