C36H28Br2O8 — CID 11072684
6,27-dibromo-8,11,16,17,22,25-hexamethoxyheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3,5,7,9,11,13,16,19,21,23,25,27,29-pentadecaene-5,28-diol (PubChem CID 11072684) has the molecular formula C36H28Br2O8 and a molecular weight of 748.42 g/mol. Its IUPAC name is 6,27-dibromo-8,11,16,17,22,25-hexamethoxyheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3,5,7,9,11,13,16,19,21,23,25,27,29-pentadecaene-5,28-diol.
| Compound Name | 6,27-dibromo-8,11,16,17,22,25-hexamethoxyheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3,5,7,9,11,13,16,19,21,23,25,27,29-pentadecaene-5,28-diol |
|---|---|
| PubChem CID | 11072684 |
| Molecular Formula | C36H28Br2O8 |
| Molecular Weight | 748.42 g/mol |
| Exact Mass | 746.02 |
| IUPAC Name | 6,27-dibromo-8,11,16,17,22,25-hexamethoxyheptacyclo[16.12.0.02,15.03,12.04,9.021,30.024,29]triaconta-1(18),2(15),3,5,7,9,11,13,16,19,21,23,25,27,29-pentadecaene-5,28-diol |
| SMILES | COc1cc(Br)c(O)c2c1cc(OC)c1ccc3c(OC)c(OC)c4ccc5c(OC)cc6c(OC)cc(Br)c(O)c6c5c4c3c12 |
| InChI | InChI=1S/C36H28Br2O8/c1-41-23-11-19-25(43-3)13-21(37)33(39)31(19)27-15(23)7-9-17-29(27)30-18(36(46-6)35(17)45-5)10-8-16-24(42-2)12-20-26(44-4)14-22(38)34(40)32(20)28(16)30/h7-14,39-40H,1-6H3 |
| InChIKey | SCCDKPMFOCUYNL-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.42 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|