C12H11BrO3 — CID 15489720
6-bromo-5,8-dimethoxynaphthalen-1-ol (PubChem CID 15489720) has the molecular formula C12H11BrO3 and a molecular weight of 283.12 g/mol. Its IUPAC name is 6-bromo-5,8-dimethoxynaphthalen-1-ol.
| Compound Name | 6-bromo-5,8-dimethoxynaphthalen-1-ol |
|---|---|
| PubChem CID | 15489720 |
| Molecular Formula | C12H11BrO3 |
| Molecular Weight | 283.12 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 6-bromo-5,8-dimethoxynaphthalen-1-ol |
| SMILES | COc1c(Br)cc(OC)c2c(O)cccc12 |
| InChI | InChI=1S/C12H11BrO3/c1-15-10-6-8(13)12(16-2)7-4-3-5-9(14)11(7)10/h3-6,14H,1-2H3 |
| InChIKey | OKHFXWQMVQAXPJ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.12 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |