C12H11ClO3 — CID 86132607
5-chloro-7,8-dimethoxynaphthalen-1-ol (PubChem CID 86132607) has the molecular formula C12H11ClO3 and a molecular weight of 238.67 g/mol. Its IUPAC name is 5-chloro-7,8-dimethoxynaphthalen-1-ol.
| Compound Name | 5-chloro-7,8-dimethoxynaphthalen-1-ol |
|---|---|
| PubChem CID | 86132607 |
| Molecular Formula | C12H11ClO3 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 5-chloro-7,8-dimethoxynaphthalen-1-ol |
| SMILES | COc1cc(Cl)c2cccc(O)c2c1OC |
| InChI | InChI=1S/C12H11ClO3/c1-15-10-6-8(13)7-4-3-5-9(14)11(7)12(10)16-2/h3-6,14H,1-2H3 |
| InChIKey | RXQFAJOMCFNMMF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |