C18H16Cl2O4 — CID 139930251
6,7-dichloro-1,4,9,10-tetramethoxyanthracene (PubChem CID 139930251) has the molecular formula C18H16Cl2O4 and a molecular weight of 367.23 g/mol. Its IUPAC name is 6,7-dichloro-1,4,9,10-tetramethoxyanthracene.
| Compound Name | 6,7-dichloro-1,4,9,10-tetramethoxyanthracene |
|---|---|
| PubChem CID | 139930251 |
| Molecular Formula | C18H16Cl2O4 |
| Molecular Weight | 367.23 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 6,7-dichloro-1,4,9,10-tetramethoxyanthracene |
| SMILES | COc1ccc(OC)c2c(OC)c3cc(Cl)c(Cl)cc3c(OC)c12 |
| InChI | InChI=1S/C18H16Cl2O4/c1-21-13-5-6-14(22-2)16-15(13)17(23-3)9-7-11(19)12(20)8-10(9)18(16)24-4/h5-8H,1-4H3 |
| InChIKey | PQMUVNDMIQENBZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.23 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|