About 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline
2-tert-butyl-4-chloro-5,8-dimethoxyquinoline (PubChem CID 43668703) has the molecular formula C15H18ClNO2
and a molecular weight of 279.77 g/mol. Its IUPAC name is 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline.
Molecular Properties
| Compound Name | 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline |
| PubChem CID | 43668703 |
| Molecular Formula | C15H18ClNO2 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline |
| SMILES | COc1ccc(OC)c2c(Cl)cc(C(C)(C)C)nc12 |
| InChI | InChI=1S/C15H18ClNO2/c1-15(2,3)12-8-9(16)13-10(18-4)6-7-11(19-5)14(13)17-12/h6-8H,1-5H3 |
| InChIKey | SKZJRMNPWATZGV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline?
The IUPAC name of 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline (CID 43668703) is 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline.
What is the SMILES notation for 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline?
The canonical SMILES for 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline is COc1ccc(OC)c2c(Cl)cc(C(C)(C)C)nc12.
What is the InChIKey of 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline?
The InChIKey is SKZJRMNPWATZGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18ClNO2/c1-15(2,3)12-8-9(16)13-10(18-4)6-7-11(19-5)14(13)17-12/h6-8H,1-5H3.
What are the key properties of 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline?
2-tert-butyl-4-chloro-5,8-dimethoxyquinoline has a molecular weight of 279.77 g/mol, XLogP of 4.20, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-4-chloro-5,8-dimethoxyquinoline is sourced from PubChem (CID 43668703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).